CAS 22255-22-7 appears in our catalog under these names: Resveratrol Trimethyl Ether, >95% (HPLC), trans-Trimethoxyresveratrol/ 99.33% (existing batch purity), trans–trismethoxy Resveratrol, 3,4',5-Trimethoxystilbene, 3,4',5-Trimethoxy-trans-stilbene, >98.0%(GC). Offered by: TRC, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 100mg, 10mg, 50mg, 10mM (in 1ml dmso), 50g, 5g, 250mg, 25g.
1,3-dimethoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene (CAS 22255-22-7) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 1,3-dimethoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene. InChIKey: GDHNBPHYVRHYCC-SNAWJCMRSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 1,3-dimethoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
| InChIKey | GDHNBPHYVRHYCC-SNAWJCMRSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C2=CC(=CC(=C2)OC)OC |
Computed by PubChem (NCBI)