CAS 2227197-31-9 appears in our catalog under these names: Methyl (3S,4S)-4-methylpyrrolidine-3-carboxylate hydrochloride, 97%, methyl (3S,4S)-4-methylpyrrolidine-3-carboxylate hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
Methyl (3S,4S)-4-methylpyrrolidine-3-carboxylate;hydrochloride (CAS 2227197-31-9) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: methyl (3S,4S)-4-methylpyrrolidine-3-carboxylate;hydrochloride. InChIKey: QKDDAMQXFDTTPL-KGZKBUQUSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | methyl (3S,4S)-4-methylpyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | QKDDAMQXFDTTPL-KGZKBUQUSA-N |
| SMILES | C[C@@H]1CNC[C@H]1C(=O)OC.Cl |
Computed by PubChem (NCBI)