Products 2227788-89-6
CAS 2227788-89-6 is the registry number for rac-(3R,5S)-1-{((9H-Fluoren-9-yl)methoxy)carbonyl}-5-methylpiperidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 10mg, 0,1g.
(3S,5R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-5-methylpiperidine-3-carboxylic acid (CAS 2227788-89-6) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: (3S,5R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-5-methylpiperidine-3-carboxylic acid. InChIKey: IHPVULHJXRINRU-CABCVRRESA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (3S,5R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-5-methylpiperidine-3-carboxylic acid |
| InChIKey | IHPVULHJXRINRU-CABCVRRESA-N |
| SMILES | C[C@@H]1C[C@@H](CN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)