Products 2227844-74-6
CAS 2227844-74-6 is the registry number for methyl (1S,3aR,7aS)-octahydro-1H-isoindole-1-carboxylate hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl (1R,3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-1-carboxylate;hydrochloride (CAS 2227844-74-6) is a chemical compound with the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. IUPAC name: methyl (1R,3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-1-carboxylate;hydrochloride. InChIKey: HMVFFJJFVUFEEO-AQLQUXDBSA-N.
| Molecular formula | C10H18ClNO2 |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | methyl (1R,3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-1-carboxylate;hydrochloride |
| InChIKey | HMVFFJJFVUFEEO-AQLQUXDBSA-N |
| SMILES | COC(=O)[C@H]1[C@@H]2CCCC[C@@H]2CN1.Cl |
Computed by PubChem (NCBI)