CAS 22280-95-1 appears in our catalog under these names: 4-(ALLYLOXY)-3-METHOXYBENZALDEHYDE, 95%, 95%, O-allylvanillin, 95%, O-allylvanillin 95%, 4-(Allyloxy)-3-methoxybenzaldehyde, 95%, O–allylvanillin. Offered by: Chemat, AmBeed, Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g, 10mM (in 1ml dmso), 100 mg, 10mM/1mL.
3-methoxy-4-prop-2-enoxybenzaldehyde (CAS 22280-95-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 3-methoxy-4-prop-2-enoxybenzaldehyde. InChIKey: DGWCHURQYFMBFC-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 3-methoxy-4-prop-2-enoxybenzaldehyde |
| InChIKey | DGWCHURQYFMBFC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OCC=C |
Computed by PubChem (NCBI)