Products 2228094-72-0
CAS 2228094-72-0 is the registry number for 2-Amino-2-(2,3-dihydro-1H-inden-1-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-2-(2,3-dihydro-1H-inden-1-yl)acetic acid;hydrochloride (CAS 2228094-72-0) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 2-amino-2-(2,3-dihydro-1H-inden-1-yl)acetic acid;hydrochloride. InChIKey: SGOVULXNCUEOTF-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 2-amino-2-(2,3-dihydro-1H-inden-1-yl)acetic acid;hydrochloride |
| InChIKey | SGOVULXNCUEOTF-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C1C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)