CAS 2228135-02-0 is the registry number for 2-Amino-7,7-dimethylbicyclo(2.2.1)heptane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid;hydrochloride (CAS 2228135-02-0) is a chemical compound with the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. IUPAC name: 2-amino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid;hydrochloride. InChIKey: FDDQAUNBAXUKGD-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO2 |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 2-amino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid;hydrochloride |
| InChIKey | FDDQAUNBAXUKGD-UHFFFAOYSA-N |
| SMILES | CC1(C2CCC1(C(C2)N)C(=O)O)C.Cl |
Computed by PubChem (NCBI)