Products 2228216-34-8
CAS 2228216-34-8 appears in our catalog under these names: 2–(3，5–difluorophenyl)–2，2–difluoroethan–1–ol, 2-(3,5-Difluorophenyl)-2,2-difluoroethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
2-(3,5-difluorophenyl)-2,2-difluoroethanol (CAS 2228216-34-8) is a chemical compound with the molecular formula C8H6F4O and a molecular weight of 194.13 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-2,2-difluoroethanol. InChIKey: KDFKXVDERQJMEM-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O |
|---|---|
| Molecular weight | 194.13 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-2,2-difluoroethanol |
| InChIKey | KDFKXVDERQJMEM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(CO)(F)F |
Computed by PubChem (NCBI)