Products 2228333-41-1
CAS 2228333-41-1 is the registry number for Methyl 2-amino-7,7-dimethylbicyclo(2.2.1)heptane-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-amino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate;hydrochloride (CAS 2228333-41-1) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: methyl 2-amino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate;hydrochloride. InChIKey: WXDXGWFAVWVZQF-UHFFFAOYSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | methyl 2-amino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate;hydrochloride |
| InChIKey | WXDXGWFAVWVZQF-UHFFFAOYSA-N |
| SMILES | CC1(C2CCC1(C(C2)N)C(=O)OC)C.Cl |
Computed by PubChem (NCBI)