CAS 2228336-54-5 appears in our catalog under these names: (1S,3s)-3-((1H-1,2,4-triazol-1-yl)methyl)cyclobutan-1-amine dihydrochloride, 98%, (1S,3S)-3-((1H-1,2,4-Triazol-1-yl)methyl)cyclobutan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
3-(1,2,4-triazol-1-ylmethyl)cyclobutan-1-amine;dihydrochloride (CAS 2228336-54-5) is a chemical compound with the molecular formula C7H14Cl2N4 and a molecular weight of 225.12 g/mol. IUPAC name: 3-(1,2,4-triazol-1-ylmethyl)cyclobutan-1-amine;dihydrochloride. InChIKey: LEFMKHDNXYOYTA-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N4 |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 3-(1,2,4-triazol-1-ylmethyl)cyclobutan-1-amine;dihydrochloride |
| InChIKey | LEFMKHDNXYOYTA-UHFFFAOYSA-N |
| SMILES | C1C(CC1N)CN2C=NC=N2.Cl.Cl |
Computed by PubChem (NCBI)