CAS 2228650-71-1 is the registry number for 3-(5-Methylpyrazin-2-yl)isoxazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-methylpyrazin-2-yl)-1,2-oxazol-5-amine (CAS 2228650-71-1) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: 3-(5-methylpyrazin-2-yl)-1,2-oxazol-5-amine. InChIKey: YLEWRQDCKQVEOA-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 3-(5-methylpyrazin-2-yl)-1,2-oxazol-5-amine |
| InChIKey | YLEWRQDCKQVEOA-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=N1)C2=NOC(=C2)N |
Computed by PubChem (NCBI)