CAS 2228763-29-7 is the registry number for 5-(3-Methoxyazetidin-3-yl)-1-methyl-1H-1,2,4-triazole dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(3-methoxyazetidin-3-yl)-1-methyl-1,2,4-triazole;dihydrochloride (CAS 2228763-29-7) is a chemical compound with the molecular formula C7H14Cl2N4O and a molecular weight of 241.12 g/mol. IUPAC name: 5-(3-methoxyazetidin-3-yl)-1-methyl-1,2,4-triazole;dihydrochloride. InChIKey: ZKIAYZMUCXAWNF-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N4O |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 5-(3-methoxyazetidin-3-yl)-1-methyl-1,2,4-triazole;dihydrochloride |
| InChIKey | ZKIAYZMUCXAWNF-UHFFFAOYSA-N |
| SMILES | CN1C(=NC=N1)C2(CNC2)OC.Cl.Cl |
Computed by PubChem (NCBI)