Products 2229682-78-2
CAS 2229682-78-2 is the registry number for N'-Hydroxy-4-(propan-2-yl)benzene-1-carboximidamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N'-hydroxy-4-propan-2-ylbenzenecarboximidamide;hydrochloride (CAS 2229682-78-2) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: N'-hydroxy-4-propan-2-ylbenzenecarboximidamide;hydrochloride. InChIKey: CKAOAPAOZPYJII-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | N'-hydroxy-4-propan-2-ylbenzenecarboximidamide;hydrochloride |
| InChIKey | CKAOAPAOZPYJII-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)/C(=N/O)/N.Cl |
Computed by PubChem (NCBI)