CAS 22300-56-7 appears in our catalog under these names: 4-Methyl-2-phenyl-1,2,3-triazole-5-carboxylic acid, 95%, 5-Methyl-2-phenyl-2H-1,2,3-triazole-4-carboxylic acid, 95%, 5-Methyl-2-phenyl-2H-1,2,3-triazole-4-carboxylic acid, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g.
5-methyl-2-phenyltriazole-4-carboxylic acid (CAS 22300-56-7) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 5-methyl-2-phenyltriazole-4-carboxylic acid. InChIKey: GQYQHAGPALBYDO-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 5-methyl-2-phenyltriazole-4-carboxylic acid |
| InChIKey | GQYQHAGPALBYDO-UHFFFAOYSA-N |
| SMILES | CC1=NN(N=C1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)