Products 2230051-33-7
CAS 2230051-33-7 appears in our catalog under these names: Tyramide alkyne, Tyramide alkyne, 99.50%, Tyramide alkyne, 99%, Tyramide alkyne, N-(4-Hydroxyphenethyl)hex-5-ynamide, ≥95% (HPLC). Offered by: GLPBio, MedChemExpress, Chemat, Sigma-Aldrich. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100 mg, 5 mg, 10mM/1mL, 50 mg.
N-[2-(4-hydroxyphenyl)ethyl]hex-5-ynamide (CAS 2230051-33-7) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: N-[2-(4-hydroxyphenyl)ethyl]hex-5-ynamide. InChIKey: LUFCBNOYEQMBTJ-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | N-[2-(4-hydroxyphenyl)ethyl]hex-5-ynamide |
| InChIKey | LUFCBNOYEQMBTJ-UHFFFAOYSA-N |
| SMILES | C#CCCCC(=O)NCCC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)