CAS 2230802-84-1 is the registry number for 6-Chloro-4-fluoro-2-methoxynicotinaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
6-chloro-4-fluoro-2-methoxypyridine-3-carbaldehyde (CAS 2230802-84-1) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 6-chloro-4-fluoro-2-methoxypyridine-3-carbaldehyde. InChIKey: VPMJOYJNPFCRHW-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 6-chloro-4-fluoro-2-methoxypyridine-3-carbaldehyde |
| InChIKey | VPMJOYJNPFCRHW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=N1)Cl)F)C=O |
Computed by PubChem (NCBI)