CAS 2230808-56-5 is the registry number for 2-(1,2-Benzoxazol-3-yl)propanedial. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(1,2-benzoxazol-3-yl)propanedial (CAS 2230808-56-5) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-(1,2-benzoxazol-3-yl)propanedial. InChIKey: ATMWWVIMVNNVPX-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-(1,2-benzoxazol-3-yl)propanedial |
| InChIKey | ATMWWVIMVNNVPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NO2)C(C=O)C=O |
Computed by PubChem (NCBI)