Products 2231663-54-8

CAS 2231663-54-8 is the registry number for trans-Methyl 3-(aminomethyl)cyclobutanecarboxylate hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 5g, 25mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-(aminomethyl)cyclobutane-1-carboxylate;hydrochloride (CAS 2231663-54-8) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: methyl 3-(aminomethyl)cyclobutane-1-carboxylate;hydrochloride. InChIKey: DEFMSHLXCSNVHM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC namemethyl 3-(aminomethyl)cyclobutane-1-carboxylate;hydrochloride
InChIKeyDEFMSHLXCSNVHM-UHFFFAOYSA-N
SMILESCOC(=O)C1CC(C1)CN.Cl

Computed by PubChem (NCBI)