CAS 22318-80-5 is the registry number for 4-[2-(3,5-Dihydroxyphenyl)ethyl]-1,2-benzenediol, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[2-(3,5-dihydroxyphenyl)ethyl]benzene-1,2-diol (CAS 22318-80-5) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: 4-[2-(3,5-dihydroxyphenyl)ethyl]benzene-1,2-diol. InChIKey: KTLRRKBJXAJHJD-UHFFFAOYSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 4-[2-(3,5-dihydroxyphenyl)ethyl]benzene-1,2-diol |
| InChIKey | KTLRRKBJXAJHJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCC2=CC(=CC(=C2)O)O)O)O |
Computed by PubChem (NCBI)