Products 223420-20-0
CAS 223420-20-0 appears in our catalog under these names: Cipralisant maleate, Cipralisant (maleate), 99%, 99%, Cipralisant (maleate), 99.84%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 50 mg, 5 mg, 10 mg, 25 mg, 1 mg.
(Z)-but-2-enedioic acid;5-[(1R,2R)-2-(5,5-dimethylhex-1-ynyl)cyclopropyl]-1H-imidazole (CAS 223420-20-0) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: (Z)-but-2-enedioic acid;5-[(1R,2R)-2-(5,5-dimethylhex-1-ynyl)cyclopropyl]-1H-imidazole. InChIKey: QIQWRCNAPQJQLL-COALEZEGSA-N.
| Molecular formula | C18H24N2O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;5-[(1R,2R)-2-(5,5-dimethylhex-1-ynyl)cyclopropyl]-1H-imidazole |
| InChIKey | QIQWRCNAPQJQLL-COALEZEGSA-N |
| SMILES | CC(C)(C)CCC#C[C@@H]1C[C@H]1C2=CN=CN2.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)