Products 874842-44-1

CAS 874842-44-1 is the registry number for 2-Ethyl-6-methylbenzenesulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-ethyl-6-methylbenzenesulfonyl chloride (CAS 874842-44-1) is a chemical compound with the molecular formula C9H11ClO2S and a molecular weight of 218.70 g/mol. IUPAC name: 2-ethyl-6-methylbenzenesulfonyl chloride. InChIKey: YVJZIVVVGXJKRO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClO2S
Molecular weight218.70 g/mol
IUPAC name2-ethyl-6-methylbenzenesulfonyl chloride
InChIKeyYVJZIVVVGXJKRO-UHFFFAOYSA-N
SMILESCCC1=CC=CC(=C1S(=O)(=O)Cl)C

Computed by PubChem (NCBI)