Products 22391-34-0
CAS 22391-34-0 appears in our catalog under these names: Aristola–1(10)，8–dien–2–one, Aristola-1(10),8-dien-2-one. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg, Get quote.
(1aR,7R,7aR,7bS)-1,1,7,7a-tetramethyl-1a,6,7,7b-tetrahydrocyclopropa[a]naphthalen-5-one (CAS 22391-34-0) is a chemical compound with the molecular formula C15H20O and a molecular weight of 216.32 g/mol. IUPAC name: (1aR,7R,7aR,7bS)-1,1,7,7a-tetramethyl-1a,6,7,7b-tetrahydrocyclopropa[a]naphthalen-5-one. InChIKey: FAGPISMIHLVLSK-JWFUOXDNSA-N.
| Molecular formula | C15H20O |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | (1aR,7R,7aR,7bS)-1,1,7,7a-tetramethyl-1a,6,7,7b-tetrahydrocyclopropa[a]naphthalen-5-one |
| InChIKey | FAGPISMIHLVLSK-JWFUOXDNSA-N |
| SMILES | C[C@@H]1CC(=O)C=C2[C@]1([C@H]3[C@H](C3(C)C)C=C2)C |
Computed by PubChem (NCBI)