CAS 2241107-34-4 is the registry number for (1S,3S)-3-((1H-1,2,3-Triazol-1-yl)methyl)cyclobutan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(triazol-1-ylmethyl)cyclobutan-1-amine;dihydrochloride (CAS 2241107-34-4) is a chemical compound with the molecular formula C7H14Cl2N4 and a molecular weight of 225.12 g/mol. IUPAC name: 3-(triazol-1-ylmethyl)cyclobutan-1-amine;dihydrochloride. InChIKey: ZGIOTHBFKAPWLM-UHFFFAOYSA-N.
| Molecular formula | C7H14Cl2N4 |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 3-(triazol-1-ylmethyl)cyclobutan-1-amine;dihydrochloride |
| InChIKey | ZGIOTHBFKAPWLM-UHFFFAOYSA-N |
| SMILES | C1C(CC1N)CN2C=CN=N2.Cl.Cl |
Computed by PubChem (NCBI)