Products 2241107-45-7
CAS 2241107-45-7 is the registry number for (1R)-1-(2,3-Dihydro-1H-indol-5-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R)-1-(2,3-dihydro-1H-indol-5-yl)ethanamine;hydrochloride (CAS 2241107-45-7) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: (1R)-1-(2,3-dihydro-1H-indol-5-yl)ethanamine;hydrochloride. InChIKey: VGROJFUHCROKRQ-OGFXRTJISA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | (1R)-1-(2,3-dihydro-1H-indol-5-yl)ethanamine;hydrochloride |
| InChIKey | VGROJFUHCROKRQ-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC2=C(C=C1)NCC2)N.Cl |
Computed by PubChem (NCBI)