Products 2241107-63-9
CAS 2241107-63-9 is the registry number for tert-Butyl (3R)-3-((1R)-1,2-dihydroxyethyl)morpholine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (3R)-3-[(1R)-1,2-dihydroxyethyl]morpholine-4-carboxylate (CAS 2241107-63-9) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl (3R)-3-[(1R)-1,2-dihydroxyethyl]morpholine-4-carboxylate. InChIKey: SIPZWTLRMCMTAN-BDAKNGLRSA-N.
| Molecular formula | C11H21NO5 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | tert-butyl (3R)-3-[(1R)-1,2-dihydroxyethyl]morpholine-4-carboxylate |
| InChIKey | SIPZWTLRMCMTAN-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@@H]1[C@H](CO)O |
Computed by PubChem (NCBI)