Products 2241127-84-2
CAS 2241127-84-2 is the registry number for 5'-(2-Methoxyphenyl)-2',3'-dihydrospiro(cyclopropane-1,1'-indene)-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-(2-methoxyphenyl)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxylic acid (CAS 2241127-84-2) is a chemical compound with the molecular formula C19H18O3 and a molecular weight of 294.3 g/mol. IUPAC name: 6-(2-methoxyphenyl)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxylic acid. InChIKey: DQCOHBWXHNAIAQ-UHFFFAOYSA-N.
| Molecular formula | C19H18O3 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 6-(2-methoxyphenyl)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxylic acid |
| InChIKey | DQCOHBWXHNAIAQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=CC3=C(C=C2)C4(CC3)CC4C(=O)O |
Computed by PubChem (NCBI)