Products 2241128-51-6
CAS 2241128-51-6 is the registry number for 4-(Hydroxymethyl)-3-oxaspiro(bicyclo(2.1.1)hexane-2,4'-oxane)-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(hydroxymethyl)spiro[2-oxabicyclo[2.1.1]hexane-3,4'-oxane]-4-carboxylic acid (CAS 2241128-51-6) is a chemical compound with the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. IUPAC name: 1-(hydroxymethyl)spiro[2-oxabicyclo[2.1.1]hexane-3,4'-oxane]-4-carboxylic acid. InChIKey: UCYZZRSSOFENTN-UHFFFAOYSA-N.
| Molecular formula | C11H16O5 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 1-(hydroxymethyl)spiro[2-oxabicyclo[2.1.1]hexane-3,4'-oxane]-4-carboxylic acid |
| InChIKey | UCYZZRSSOFENTN-UHFFFAOYSA-N |
| SMILES | C1COCCC12C3(CC(C3)(O2)CO)C(=O)O |
Computed by PubChem (NCBI)