CAS 2241131-18-8 is the registry number for 3-(4-({((tert-Butoxy)carbonyl)amino}methyl)phenyl)-2,2-dimethylpropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,2-dimethyl-3-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]propanoic acid (CAS 2241131-18-8) is a chemical compound with the molecular formula C17H25NO4 and a molecular weight of 307.4 g/mol. IUPAC name: 2,2-dimethyl-3-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]propanoic acid. InChIKey: OGXURWSVDJBCOG-UHFFFAOYSA-N.
| Molecular formula | C17H25NO4 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 2,2-dimethyl-3-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]propanoic acid |
| InChIKey | OGXURWSVDJBCOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=C(C=C1)CC(C)(C)C(=O)O |
Computed by PubChem (NCBI)