Products 2241131-19-9
CAS 2241131-19-9 is the registry number for 3-(3-(Pyrimidin-5-yl)phenyl)piperazin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3-pyrimidin-5-ylphenyl)piperazin-2-one (CAS 2241131-19-9) is a chemical compound with the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. IUPAC name: 3-(3-pyrimidin-5-ylphenyl)piperazin-2-one. InChIKey: YFQLSGSKXVSNRX-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O |
|---|---|
| Molecular weight | 254.29 g/mol |
| IUPAC name | 3-(3-pyrimidin-5-ylphenyl)piperazin-2-one |
| InChIKey | YFQLSGSKXVSNRX-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C(N1)C2=CC=CC(=C2)C3=CN=CN=C3 |
Computed by PubChem (NCBI)