Products 2241139-25-1
CAS 2241139-25-1 is the registry number for 1-(tert-Butyl) 2-methyl (2R,4S)-4-fluoro-2-methylpyrrolidine-1,2-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-O-tert-butyl 2-O-methyl (2R,4S)-4-fluoro-2-methylpyrrolidine-1,2-dicarboxylate (CAS 2241139-25-1) is a chemical compound with the molecular formula C12H20FNO4 and a molecular weight of 261.29 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-fluoro-2-methylpyrrolidine-1,2-dicarboxylate. InChIKey: STIFXDDZUNPDST-QPUJVOFHSA-N.
| Molecular formula | C12H20FNO4 |
|---|---|
| Molecular weight | 261.29 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-fluoro-2-methylpyrrolidine-1,2-dicarboxylate |
| InChIKey | STIFXDDZUNPDST-QPUJVOFHSA-N |
| SMILES | C[C@@]1(C[C@@H](CN1C(=O)OC(C)(C)C)F)C(=O)OC |
Computed by PubChem (NCBI)