CAS 2241504-56-1 is the registry number for Methyl 6-Hydroxy-2,2,4,4-tetramethylcyclohexanecarboxylate. Offered by: TRC. Available pack sizes: 1g.
Methyl 6-hydroxy-2,2,4,4-tetramethylcyclohexane-1-carboxylate (CAS 2241504-56-1) is a chemical compound with the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. IUPAC name: methyl 6-hydroxy-2,2,4,4-tetramethylcyclohexane-1-carboxylate. InChIKey: HPCDMIDALPUFCB-UHFFFAOYSA-N.
| Molecular formula | C12H22O3 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | methyl 6-hydroxy-2,2,4,4-tetramethylcyclohexane-1-carboxylate |
| InChIKey | HPCDMIDALPUFCB-UHFFFAOYSA-N |
| SMILES | CC1(CC(C(C(C1)(C)C)C(=O)OC)O)C |
Computed by PubChem (NCBI)