Products 2241594-16-9
CAS 2241594-16-9 appears in our catalog under these names: 3-(Pyrrolidin-2-yl)benzoic acid hydrochloride, 98%, 98%, 3-(PYRROLIDIN-2-YL)BENZOIC ACID HCL, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-pyrrolidin-2-ylbenzoic acid;hydrochloride (CAS 2241594-16-9) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 3-pyrrolidin-2-ylbenzoic acid;hydrochloride. InChIKey: PVVCFTFXCAGXRM-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 3-pyrrolidin-2-ylbenzoic acid;hydrochloride |
| InChIKey | PVVCFTFXCAGXRM-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC(=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)