Products 22426-47-7
CAS 22426-47-7 appears in our catalog under these names: 2,6-Naphthalenediol diacetate, 95%, Naphthalene-2,6-diyl diacetate, 95+%, 2，6–Diacetoxynaphthalene, 2,6-Diacetoxynaphthalene, >99.0%(GC), 2,6-Naphthalenediol diacetate, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg.
(6-acetyloxynaphthalen-2-yl) acetate (CAS 22426-47-7) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: (6-acetyloxynaphthalen-2-yl) acetate. InChIKey: JTUIDPCUTRXCPW-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | (6-acetyloxynaphthalen-2-yl) acetate |
| InChIKey | JTUIDPCUTRXCPW-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C=C(C=C2)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
2,6-Diacetoxynaphthalene, Naphthalene-2,6-diyl diacetate, 2,6-Naphthalenediol diacetate, (6-acetyloxynaphthalen-2-yl) acetate, 6-(acetyloxy)naphthalen-2-yl acetate, 2,6-Diacetoxyl naphthalene, 2,6-Dacetoxynaphthalene, Naphthalene-2,6-diyldiacetate, (6-acetoxy-2-naphthyl) acetate, 6-(Acetyloxy)-2-naphthyl acetate #