CAS 22428-30-4 appears in our catalog under these names: 3,3'–Dihydroxy–4,4'–diaminodiphenylmethane, 5,5'-Methylenebis(2-aminophenol). Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 1000mg, 2000mg, 5000mg.
2-amino-5-[(4-amino-3-hydroxyphenyl)methyl]phenol (CAS 22428-30-4) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 2-amino-5-[(4-amino-3-hydroxyphenyl)methyl]phenol. InChIKey: RCYNJDVUURMJOZ-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 2-amino-5-[(4-amino-3-hydroxyphenyl)methyl]phenol |
| InChIKey | RCYNJDVUURMJOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC2=CC(=C(C=C2)N)O)O)N |
Computed by PubChem (NCBI)