CAS 2243-90-5 is the registry number for 2,6,8-Trimethylquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
2,6,8-trimethylquinoline (CAS 2243-90-5) is a chemical compound with the molecular formula C12H13N and a molecular weight of 171.24 g/mol. IUPAC name: 2,6,8-trimethylquinoline. InChIKey: TYDCAWVQILIWGV-UHFFFAOYSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | 2,6,8-trimethylquinoline |
| InChIKey | TYDCAWVQILIWGV-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2C=C1)C)C |
Computed by PubChem (NCBI)