Products 2243508-08-7

CAS 2243508-08-7 is the registry number for Methyl 3-(cyclopropylmethyl)-4-hydroxy-5-methoxybenzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 3-(cyclopropylmethyl)-4-hydroxy-5-methoxybenzoate (CAS 2243508-08-7) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: methyl 3-(cyclopropylmethyl)-4-hydroxy-5-methoxybenzoate. InChIKey: NWHICIVYQMATGK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O4
Molecular weight236.26 g/mol
IUPAC namemethyl 3-(cyclopropylmethyl)-4-hydroxy-5-methoxybenzoate
InChIKeyNWHICIVYQMATGK-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1O)CC2CC2)C(=O)OC

Computed by PubChem (NCBI)