Products 2243512-81-2
CAS 2243512-81-2 is the registry number for rac-Ethyl (1R,2R)-2-(ethoxymethanimidoyl)cyclopropane-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Trans-ethyl (1R,2R)-2-(C-ethoxycarbonimidoyl)cyclopropane-1-carboxylate;hydrochloride (CAS 2243512-81-2) is a chemical compound with the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-(C-ethoxycarbonimidoyl)cyclopropane-1-carboxylate;hydrochloride. InChIKey: GQECZYQFORQHMT-ZJLYAJKPSA-N.
| Molecular formula | C9H16ClNO3 |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-(C-ethoxycarbonimidoyl)cyclopropane-1-carboxylate;hydrochloride |
| InChIKey | GQECZYQFORQHMT-ZJLYAJKPSA-N |
| SMILES | CCOC(=N)[C@@H]1C[C@H]1C(=O)OCC.Cl |
Computed by PubChem (NCBI)