CAS 2248-46-6 appears in our catalog under these names: Ethyl 2,2-difluoro-2-phenylacetate, 96%, Ethyl 2,2–difluoro–2–phenylacetate, Ethyl 2,2-difluoro-2-phenylacetate 95%, Ethyl 2,2-difluoro-2-phenylacetate, 95%, 95%, Ethyl 2,2-Difluoro-2-phenylacetate. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 250mg.
Ethyl 2,2-difluoro-2-phenylacetate (CAS 2248-46-6) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: ethyl 2,2-difluoro-2-phenylacetate. InChIKey: KCMSDCHUELUJPX-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | ethyl 2,2-difluoro-2-phenylacetate |
| InChIKey | KCMSDCHUELUJPX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC=CC=C1)(F)F |
Computed by PubChem (NCBI)