Products 2248175-18-8
CAS 2248175-18-8 is the registry number for 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1S)-2,2-dimethylcyclopropane-1-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
(1,3-dioxoisoindol-2-yl) (1S)-2,2-dimethylcyclopropane-1-carboxylate (CAS 2248175-18-8) is a chemical compound with the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) (1S)-2,2-dimethylcyclopropane-1-carboxylate. InChIKey: ZNJXXFDALYNQRD-SNVBAGLBSA-N.
| Molecular formula | C14H13NO4 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) (1S)-2,2-dimethylcyclopropane-1-carboxylate |
| InChIKey | ZNJXXFDALYNQRD-SNVBAGLBSA-N |
| SMILES | CC1(C[C@@H]1C(=O)ON2C(=O)C3=CC=CC=C3C2=O)C |
Computed by PubChem (NCBI)