Products 2248278-00-2
CAS 2248278-00-2 is the registry number for 4-((TERT-BUTOXYCARBONYL)AMINO)-1-ETHYL-3-METHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
1-ethyl-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-5-carboxylic acid (CAS 2248278-00-2) is a chemical compound with the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. IUPAC name: 1-ethyl-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-5-carboxylic acid. InChIKey: RMEPZWDVRJFMTM-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O4 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | 1-ethyl-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazole-5-carboxylic acid |
| InChIKey | RMEPZWDVRJFMTM-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)NC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)