CAS 2248301-38-2 appears in our catalog under these names: 4-(Dimethylamino)bicyclo(2.2.2)octane-1-carboxylic acid hydrochloride, 98%, 4-(Dimethylamino)bicyclo(2.2.2)octane-1-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(dimethylamino)bicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride (CAS 2248301-38-2) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: 4-(dimethylamino)bicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride. InChIKey: MGWAEKOIMCIYKA-UHFFFAOYSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | 4-(dimethylamino)bicyclo[2.2.2]octane-1-carboxylic acid;hydrochloride |
| InChIKey | MGWAEKOIMCIYKA-UHFFFAOYSA-N |
| SMILES | CN(C)C12CCC(CC1)(CC2)C(=O)O.Cl |
Computed by PubChem (NCBI)