Products 2250241-87-1
CAS 2250241-87-1 appears in our catalog under these names: (R)-1-(2,3-DIHYDROBENZOFURAN-5-YL)ETHAN-1-AMINE HCL, 98%, (R)-1-(2,3-Dihydrobenzofuran-5-yl)ethanamine hydrochloride, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R)-1-(2,3-dihydro-1-benzofuran-5-yl)ethanamine;hydrochloride (CAS 2250241-87-1) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (1R)-1-(2,3-dihydro-1-benzofuran-5-yl)ethanamine;hydrochloride. InChIKey: BHMMVEYJSQNKIW-OGFXRTJISA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (1R)-1-(2,3-dihydro-1-benzofuran-5-yl)ethanamine;hydrochloride |
| InChIKey | BHMMVEYJSQNKIW-OGFXRTJISA-N |
| SMILES | C[C@H](C1=CC2=C(C=C1)OCC2)N.Cl |
Computed by PubChem (NCBI)