Products 2771237-67-1
CAS 2771237-67-1 appears in our catalog under these names: (S)-1-(2,3-Dihydrobenzofuran-5-yl)ethan-1-amine hydrochloride, 98%, (S)-1-(2,3-Dihydrobenzofuran-5-yl)ethan-1-amine hydrochloride, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethanamine;hydrochloride (CAS 2771237-67-1) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethanamine;hydrochloride. InChIKey: BHMMVEYJSQNKIW-FJXQXJEOSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethanamine;hydrochloride |
| InChIKey | BHMMVEYJSQNKIW-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)OCC2)N.Cl |
Computed by PubChem (NCBI)