CAS 2250242-03-4 appears in our catalog under these names: (S)-(4-BROMO-3-METHYLPHENYL)(CYCLOPROPYL)METHANAMINE HCL, 95%, (s)-(4-Bromo-3-methylphenyl)(cyclopropyl)methanamine hydrochloride, 95%, 95%, (S)-(4-BROMO-3-METHYLPHENYL)(CYCLOPROPYL)METHANAMINE HCL, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(S)-(4-bromo-3-methylphenyl)-cyclopropylmethanamine;hydrochloride (CAS 2250242-03-4) is a chemical compound with the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. IUPAC name: (S)-(4-bromo-3-methylphenyl)-cyclopropylmethanamine;hydrochloride. InChIKey: RIZVKUOFLAWWJH-MERQFXBCSA-N.
| Molecular formula | C11H15BrClN |
|---|---|
| Molecular weight | 276.60 g/mol |
| IUPAC name | (S)-(4-bromo-3-methylphenyl)-cyclopropylmethanamine;hydrochloride |
| InChIKey | RIZVKUOFLAWWJH-MERQFXBCSA-N |
| SMILES | CC1=C(C=CC(=C1)[C@H](C2CC2)N)Br.Cl |
Computed by PubChem (NCBI)