CAS 2250242-41-0 appears in our catalog under these names: 2-Chloro-5-methylamino-benzoic acid methyl ester, 95%, 95%, (R)-(4-BROMO-3-METHYLPHENYL)(CYCLOPROPYL)METHANAMINE HCL, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(R)-(4-bromo-3-methylphenyl)-cyclopropylmethanamine;hydrochloride (CAS 2250242-41-0) is a chemical compound with the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. IUPAC name: (R)-(4-bromo-3-methylphenyl)-cyclopropylmethanamine;hydrochloride. InChIKey: RIZVKUOFLAWWJH-RFVHGSKJSA-N.
| Molecular formula | C11H15BrClN |
|---|---|
| Molecular weight | 276.60 g/mol |
| IUPAC name | (R)-(4-bromo-3-methylphenyl)-cyclopropylmethanamine;hydrochloride |
| InChIKey | RIZVKUOFLAWWJH-RFVHGSKJSA-N |
| SMILES | CC1=C(C=CC(=C1)[C@@H](C2CC2)N)Br.Cl |
Computed by PubChem (NCBI)