CAS 2250243-10-6 appears in our catalog under these names: (R)-8-CHLOROCHROMAN-4-AMINE HCL, 98%, (r)-8-Chlorochroman-4-amine hydrochloride, 97%, 97%, (R)-8-CHLOROCHROMAN-4-AMINE HCL, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(4R)-8-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 2250243-10-6) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: (4R)-8-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: BXLLHMUHNIPMNB-DDWIOCJRSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | (4R)-8-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | BXLLHMUHNIPMNB-DDWIOCJRSA-N |
| SMILES | C1COC2=C([C@@H]1N)C=CC=C2Cl.Cl |
Computed by PubChem (NCBI)