Products 2250243-66-2

CAS 2250243-66-2 is the registry number for 3-Chloro-1,6-naphthyridine-7-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

3-chloro-1,6-naphthyridine-7-carboxylic acid (CAS 2250243-66-2) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 3-chloro-1,6-naphthyridine-7-carboxylic acid. InChIKey: XMDCUMJLXPHAEC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClN2O2
Molecular weight208.60 g/mol
IUPAC name3-chloro-1,6-naphthyridine-7-carboxylic acid
InChIKeyXMDCUMJLXPHAEC-UHFFFAOYSA-N
SMILESC1=C2C=NC(=CC2=NC=C1Cl)C(=O)O

Computed by PubChem (NCBI)