CAS 2253629-88-6 is the registry number for 6-(Propane-2-sulfonyl)quinolin-4-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-propan-2-ylsulfonyl-1H-quinolin-4-one (CAS 2253629-88-6) is a chemical compound with the molecular formula C12H13NO3S and a molecular weight of 251.30 g/mol. IUPAC name: 6-propan-2-ylsulfonyl-1H-quinolin-4-one. InChIKey: QIBGYLXNKWMVPJ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3S |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | 6-propan-2-ylsulfonyl-1H-quinolin-4-one |
| InChIKey | QIBGYLXNKWMVPJ-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=CC2=C(C=C1)NC=CC2=O |
Computed by PubChem (NCBI)