CAS 2253631-10-4 is the registry number for 3,3-Difluoro-2-phenylpropan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,3-difluoro-2-phenylpropan-1-amine;hydrochloride (CAS 2253631-10-4) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: 3,3-difluoro-2-phenylpropan-1-amine;hydrochloride. InChIKey: LCFLLIVHNJPRPH-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 3,3-difluoro-2-phenylpropan-1-amine;hydrochloride |
| InChIKey | LCFLLIVHNJPRPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN)C(F)F.Cl |
Computed by PubChem (NCBI)