Products 2253631-63-7
CAS 2253631-63-7 is the registry number for rac-Ethyl (3aR,7aS)-octahydro-1H-indole-3a-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl (3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxylate;hydrochloride (CAS 2253631-63-7) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: ethyl (3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxylate;hydrochloride. InChIKey: JPXJVBCLVVXKFF-QLSWKGBWSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | ethyl (3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxylate;hydrochloride |
| InChIKey | JPXJVBCLVVXKFF-QLSWKGBWSA-N |
| SMILES | CCOC(=O)[C@@]12CCCC[C@@H]1NCC2.Cl |
Computed by PubChem (NCBI)